ChemNet > CAS > 1455-18-1 3-Methylbenzo[b]thiophene
1455-18-1 3-Methylbenzo[b]thiophene
| Ονομασία του προϊόντος |
3-Methylbenzo[b]thiophene |
| Αγγλικό όνομα |
3-Methylbenzo[b]thiophene; Methylbenzobthiophene; 3-Methylthianaphthene; 3-methyl-1-benzothiophene |
| MF |
C9H8S |
| Μοριακό βάρος |
148.2248 |
| InChI |
InChI=1/C9H8S/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6H,1H3 |
| CAS ΟΧΙ |
1455-18-1 |
| EINECS |
215-934-6 |
| Μοριακή δομή |
![1455-18-1 3-Methylbenzo[b]thiophene](https://images-a.chemnet.com/suppliers/chembase/485/136485.gif)
|
| Πυκνότητα |
1.146g/cm3 |
| Σημείο βρασμού |
243°C at 760 mmHg |
| Δείκτης διάθλασης |
1.652 |
| Σημείο ανάφλεξης |
72.4°C |
| Πίεση ατμών |
0.0514mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
